C14H20N2O6Si — CID 101280467
[(2R,4R,5R,6S)-10-oxo-4-(trimethylsilyloxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] acetate (PubChem CID 101280467) has the molecular formula C14H20N2O6Si and a molecular weight of 340.41 g/mol. Its IUPAC name is [(2R,4R,5R,6S)-10-oxo-4-(trimethylsilyloxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] acetate.
| Compound Name | [(2R,4R,5R,6S)-10-oxo-4-(trimethylsilyloxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] acetate |
|---|---|
| PubChem CID | 101280467 |
| Molecular Formula | C14H20N2O6Si |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [(2R,4R,5R,6S)-10-oxo-4-(trimethylsilyloxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2Oc3nc(=O)ccn3[C@@H]2O[C@@H]1CO[Si](C)(C)C |
| InChI | InChI=1S/C14H20N2O6Si/c1-8(17)20-11-9(7-19-23(2,3)4)21-13-12(11)22-14-15-10(18)5-6-16(13)14/h5-6,9,11-13H,7H2,1-4H3/t9-,11-,12+,13-/m1/s1 |
| InChIKey | LIZXEPAUETVZLT-FOUMNBMASA-N |
| XLogP | 0.68 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|