C16H21N3O6 — CID 90677759
[(2R,4R,5R,6S)-5-acetyloxy-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl 2,2-dimethylpropanoate (PubChem CID 90677759) has the molecular formula C16H21N3O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is [(2R,4R,5R,6S)-5-acetyloxy-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,4R,5R,6S)-5-acetyloxy-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 90677759 |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | [(2R,4R,5R,6S)-5-acetyloxy-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl 2,2-dimethylpropanoate |
| SMILES | [H]/N=c1\ccn2c(n1)O[C@H]1[C@H](OC(C)=O)[C@@H](COC(=O)C(C)(C)C)O[C@H]12 |
| InChI | InChI=1S/C16H21N3O6/c1-8(20)23-11-9(7-22-14(21)16(2,3)4)24-13-12(11)25-15-18-10(17)5-6-19(13)15/h5-6,9,11-13,17H,7H2,1-4H3/b17-10+/t9-,11-,12+,13-/m1/s1 |
| InChIKey | YPRLCACCNWKHQB-YAYBMZQESA-N |
| XLogP | 0.54 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |