C10H19Na2O7P — CID 20706015
disodium;[4-hydroxy-6-(hydroxymethyl)-3,3,5,5-tetramethyloxan-2-yl] phosphate (PubChem CID 20706015) has the molecular formula C10H19Na2O7P and a molecular weight of 328.21 g/mol. Its IUPAC name is disodium;[4-hydroxy-6-(hydroxymethyl)-3,3,5,5-tetramethyloxan-2-yl] phosphate.
| Compound Name | disodium;[4-hydroxy-6-(hydroxymethyl)-3,3,5,5-tetramethyloxan-2-yl] phosphate |
|---|---|
| PubChem CID | 20706015 |
| Molecular Formula | C10H19Na2O7P |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | disodium;[4-hydroxy-6-(hydroxymethyl)-3,3,5,5-tetramethyloxan-2-yl] phosphate |
| SMILES | CC1(C)C(CO)OC(OP(=O)([O-])[O-])C(C)(C)C1O.[Na+].[Na+] |
| InChI | InChI=1S/C10H21O7P.2Na/c1-9(2)6(5-11)16-8(17-18(13,14)15)10(3,4)7(9)12;;/h6-8,11-12H,5H2,1-4H3,(H2,13,14,15);;/q;2*+1/p-2 |
| InChIKey | RXHVYJZXKFGLHA-UHFFFAOYSA-L |
| XLogP | -7.03 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | -7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|