C40H51N5O8S — CID 20707427
2-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methoxyphenyl]sulfinamoyloxy-4-methylphenoxy]decanoic acid (PubChem CID 20707427) has the molecular formula C40H51N5O8S and a molecular weight of 761.94 g/mol. Its IUPAC name is 2-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methoxyphenyl]sulfinamoyloxy-4-methylphenoxy]decanoic acid.
| Compound Name | 2-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methoxyphenyl]sulfinamoyloxy-4-methylphenoxy]decanoic acid |
|---|---|
| PubChem CID | 20707427 |
| Molecular Formula | C40H51N5O8S |
| Molecular Weight | 761.94 g/mol |
| Exact Mass | 761.35 |
| IUPAC Name | 2-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methoxyphenyl]sulfinamoyloxy-4-methylphenoxy]decanoic acid |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(OC)c(NS(=O)Oc4cc(C)ccc4OC(CCCCCCCC)C(=O)O)c3)nc2c1C(=O)OC1C(C)CC(C)CC1C |
| InChI | InChI=1S/C40H51N5O8S/c1-8-9-10-11-12-13-14-33(39(46)47)51-32-17-15-24(2)21-34(32)53-54(49)44-29-22-28(16-18-31(29)50-7)37-42-38-35(30(41-6)23-45(38)43-37)40(48)52-36-26(4)19-25(3)20-27(36)5/h15-18,21-23,25-27,33,36,44H,8-14,19-20H2,1-5,7H3,(H,42,43)(H,46,47) |
| InChIKey | URMMVVNRIKXWTE-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.94 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|