C44H61N5O4S — CID 20615935
(2,6-ditert-butyl-4-methylcyclohexyl) 6-isocyano-2-[4-methyl-3-[[2-methyl-5-(2,4,4-trimethylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20615935) has the molecular formula C44H61N5O4S and a molecular weight of 756.07 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylcyclohexyl) 6-isocyano-2-[4-methyl-3-[[2-methyl-5-(2,4,4-trimethylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methylcyclohexyl) 6-isocyano-2-[4-methyl-3-[[2-methyl-5-(2,4,4-trimethylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20615935 |
| Molecular Formula | C44H61N5O4S |
| Molecular Weight | 756.07 g/mol |
| Exact Mass | 755.44 |
| IUPAC Name | (2,6-ditert-butyl-4-methylcyclohexyl) 6-isocyano-2-[4-methyl-3-[[2-methyl-5-(2,4,4-trimethylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(C)c(NS(=O)Oc4cc(C(C)(C)CC(C)(C)C)ccc4C)c3)nc2c1C(=O)OC1C(C(C)(C)C)CC(C)CC1C(C)(C)C |
| InChI | InChI=1S/C44H61N5O4S/c1-26-20-31(42(7,8)9)37(32(21-26)43(10,11)12)52-40(50)36-34(45-15)24-49-39(36)46-38(47-49)29-18-16-27(2)33(22-29)48-54(51)53-35-23-30(19-17-28(35)3)44(13,14)25-41(4,5)6/h16-19,22-24,26,31-32,37,48H,20-21,25H2,1-14H3,(H,46,47) |
| InChIKey | YRVMSTYEGULAEO-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.07 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|