C21H17ClF2N2O2 — CID 20708919
(4-chlorophenyl) 4-(5-butylpyrimidin-2-yl)-2,6-difluorobenzoate (PubChem CID 20708919) has the molecular formula C21H17ClF2N2O2 and a molecular weight of 402.83 g/mol. Its IUPAC name is (4-chlorophenyl) 4-(5-butylpyrimidin-2-yl)-2,6-difluorobenzoate.
| Compound Name | (4-chlorophenyl) 4-(5-butylpyrimidin-2-yl)-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 20708919 |
| Molecular Formula | C21H17ClF2N2O2 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (4-chlorophenyl) 4-(5-butylpyrimidin-2-yl)-2,6-difluorobenzoate |
| SMILES | CCCCc1cnc(-c2cc(F)c(C(=O)Oc3ccc(Cl)cc3)c(F)c2)nc1 |
| InChI | InChI=1S/C21H17ClF2N2O2/c1-2-3-4-13-11-25-20(26-12-13)14-9-17(23)19(18(24)10-14)21(27)28-16-7-5-15(22)6-8-16/h5-12H,2-4H2,1H3 |
| InChIKey | WHYNLKMIZUWUSJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|