C15H21N7O5 — CID 20709770
(3S)-4-amino-3-[2-[[2-[3-(diaminomethylideneamino)phenyl]acetyl]-methylcarbamoyl]hydrazinyl]-4-oxobutanoic acid (PubChem CID 20709770) has the molecular formula C15H21N7O5 and a molecular weight of 379.38 g/mol. Its IUPAC name is (3S)-4-amino-3-[2-[[2-[3-(diaminomethylideneamino)phenyl]acetyl]-methylcarbamoyl]hydrazinyl]-4-oxobutanoic acid.
| Compound Name | (3S)-4-amino-3-[2-[[2-[3-(diaminomethylideneamino)phenyl]acetyl]-methylcarbamoyl]hydrazinyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20709770 |
| Molecular Formula | C15H21N7O5 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (3S)-4-amino-3-[2-[[2-[3-(diaminomethylideneamino)phenyl]acetyl]-methylcarbamoyl]hydrazinyl]-4-oxobutanoic acid |
| SMILES | CN(C(=O)Cc1cccc(N=C(N)N)c1)C(=O)NN[C@@H](CC(=O)O)C(N)=O |
| InChI | InChI=1S/C15H21N7O5/c1-22(15(27)21-20-10(13(16)26)7-12(24)25)11(23)6-8-3-2-4-9(5-8)19-14(17)18/h2-5,10,20H,6-7H2,1H3,(H2,16,26)(H,21,27)(H,24,25)(H4,17,18,19)/t10-/m0/s1 |
| InChIKey | ZSTIOJHJFOBAFO-JTQLQIEISA-N |
| XLogP | -1.86 |
| TPSA | 206.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|