C40H47N3O8S — CID 20713096
N,N'-bis[2-(3,4-dimethoxyphenyl)ethyl]-2-[[(2S)-2-[(4-methoxyphenyl)methylsulfanyl]-3-phenylpropanoyl]amino]propanediamide (PubChem CID 20713096) has the molecular formula C40H47N3O8S and a molecular weight of 729.90 g/mol. Its IUPAC name is N,N'-bis[2-(3,4-dimethoxyphenyl)ethyl]-2-[[(2S)-2-[(4-methoxyphenyl)methylsulfanyl]-3-phenylpropanoyl]amino]propanediamide.
| Compound Name | N,N'-bis[2-(3,4-dimethoxyphenyl)ethyl]-2-[[(2S)-2-[(4-methoxyphenyl)methylsulfanyl]-3-phenylpropanoyl]amino]propanediamide |
|---|---|
| PubChem CID | 20713096 |
| Molecular Formula | C40H47N3O8S |
| Molecular Weight | 729.90 g/mol |
| Exact Mass | 729.31 |
| IUPAC Name | N,N'-bis[2-(3,4-dimethoxyphenyl)ethyl]-2-[[(2S)-2-[(4-methoxyphenyl)methylsulfanyl]-3-phenylpropanoyl]amino]propanediamide |
| SMILES | COc1ccc(CS[C@@H](Cc2ccccc2)C(=O)NC(C(=O)NCCc2ccc(OC)c(OC)c2)C(=O)NCCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C40H47N3O8S/c1-47-31-15-11-30(12-16-31)26-52-36(25-27-9-7-6-8-10-27)38(44)43-37(39(45)41-21-19-28-13-17-32(48-2)34(23-28)50-4)40(46)42-22-20-29-14-18-33(49-3)35(24-29)51-5/h6-18,23-24,36-37H,19-22,25-26H2,1-5H3,(H,41,45)(H,42,46)(H,43,44)/t36-/m0/s1 |
| InChIKey | POSXWIIJKGIRDT-BHVANESWSA-N |
| XLogP | 4.78 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.90 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|