C6H13N3S+2 — CID 20717640
1,2,4,5-tetramethyl-1,2,4-triazole-2,4-diium-3-thiol (PubChem CID 20717640) has the molecular formula C6H13N3S+2 and a molecular weight of 159.26 g/mol. Its IUPAC name is 1,2,4,5-tetramethyl-1,2,4-triazole-2,4-diium-3-thiol.
| Compound Name | 1,2,4,5-tetramethyl-1,2,4-triazole-2,4-diium-3-thiol |
|---|---|
| PubChem CID | 20717640 |
| Molecular Formula | C6H13N3S+2 |
| Molecular Weight | 159.26 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 1,2,4,5-tetramethyl-1,2,4-triazole-2,4-diium-3-thiol |
| SMILES | Cc1n(C)[n+](C)c(S)[n+]1C |
| InChI | InChI=1S/C6H12N3S/c1-5-7(2)6(10)9(4)8(5)3/h1-4H3/q+1/p+1 |
| InChIKey | IHGUOPUGJONPLZ-UHFFFAOYSA-O |
| XLogP | -0.73 |
| TPSA | 12.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.26 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|