C22H26N2O3S — CID 2071811
N-(1,3-benzothiazol-2-yl)-3-(4-butoxy-3-ethoxyphenyl)propanamide (PubChem CID 2071811) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-3-(4-butoxy-3-ethoxyphenyl)propanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-3-(4-butoxy-3-ethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 2071811 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-3-(4-butoxy-3-ethoxyphenyl)propanamide |
| SMILES | CCCCOc1ccc(CCC(=O)Nc2nc3ccccc3s2)cc1OCC |
| InChI | InChI=1S/C22H26N2O3S/c1-3-5-14-27-18-12-10-16(15-19(18)26-4-2)11-13-21(25)24-22-23-17-8-6-7-9-20(17)28-22/h6-10,12,15H,3-5,11,13-14H2,1-2H3,(H,23,24,25) |
| InChIKey | MHVFAMPIUGMHQP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|