C21H18N2O5S — CID 54187924
4-[4-[3-(1,3-benzothiazol-2-ylamino)-3-oxopropyl]-2-methoxyphenyl]-4-oxobut-2-enoic acid (PubChem CID 54187924) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is 4-[4-[3-(1,3-benzothiazol-2-ylamino)-3-oxopropyl]-2-methoxyphenyl]-4-oxobut-2-enoic acid.
| Compound Name | 4-[4-[3-(1,3-benzothiazol-2-ylamino)-3-oxopropyl]-2-methoxyphenyl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54187924 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 4-[4-[3-(1,3-benzothiazol-2-ylamino)-3-oxopropyl]-2-methoxyphenyl]-4-oxobut-2-enoic acid |
| SMILES | COc1cc(CCC(=O)Nc2nc3ccccc3s2)ccc1C(=O)C=CC(=O)O |
| InChI | InChI=1S/C21H18N2O5S/c1-28-17-12-13(6-8-14(17)16(24)9-11-20(26)27)7-10-19(25)23-21-22-15-4-2-3-5-18(15)29-21/h2-6,8-9,11-12H,7,10H2,1H3,(H,26,27)(H,22,23,25) |
| InChIKey | PGKMTTUKLDFUEY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|