C27H30N6O2 — CID 20721778
2-N-(3,4-dimethoxyphenyl)-4-N,6-N-bis(3,4-dimethylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 20721778) has the molecular formula C27H30N6O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 2-N-(3,4-dimethoxyphenyl)-4-N,6-N-bis(3,4-dimethylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(3,4-dimethoxyphenyl)-4-N,6-N-bis(3,4-dimethylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 20721778 |
| Molecular Formula | C27H30N6O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 2-N-(3,4-dimethoxyphenyl)-4-N,6-N-bis(3,4-dimethylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(Nc2nc(Nc3ccc(C)c(C)c3)nc(Nc3ccc(C)c(C)c3)n2)cc1OC |
| InChI | InChI=1S/C27H30N6O2/c1-16-7-9-20(13-18(16)3)28-25-31-26(29-21-10-8-17(2)19(4)14-21)33-27(32-25)30-22-11-12-23(34-5)24(15-22)35-6/h7-15H,1-6H3,(H3,28,29,30,31,32,33) |
| InChIKey | GKJGZJOPHHZAAE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |