C22H23N3 — CID 20724867
3-[(E)-1,2-diphenylethenyl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine (PubChem CID 20724867) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is 3-[(E)-1,2-diphenylethenyl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine.
| Compound Name | 3-[(E)-1,2-diphenylethenyl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
|---|---|
| PubChem CID | 20724867 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 3-[(E)-1,2-diphenylethenyl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
| SMILES | C(=C(\c1ccccc1)c1nnc2n1CCCCCC2)\c1ccccc1 |
| InChI | InChI=1S/C22H23N3/c1-2-10-16-25-21(15-9-1)23-24-22(25)20(19-13-7-4-8-14-19)17-18-11-5-3-6-12-18/h3-8,11-14,17H,1-2,9-10,15-16H2/b20-17+ |
| InChIKey | LYSACAKBJVJMMC-LVZFUZTISA-N |
| XLogP | 4.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|