C23H33N5O4S — CID 20725379
2-[2-[4-[(4-butylphenyl)sulfonylamino]phenyl]hydrazinyl]-N-[3-(dimethylamino)propyl]-2-oxoacetamide (PubChem CID 20725379) has the molecular formula C23H33N5O4S and a molecular weight of 475.62 g/mol. Its IUPAC name is 2-[2-[4-[(4-butylphenyl)sulfonylamino]phenyl]hydrazinyl]-N-[3-(dimethylamino)propyl]-2-oxoacetamide.
| Compound Name | 2-[2-[4-[(4-butylphenyl)sulfonylamino]phenyl]hydrazinyl]-N-[3-(dimethylamino)propyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 20725379 |
| Molecular Formula | C23H33N5O4S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 2-[2-[4-[(4-butylphenyl)sulfonylamino]phenyl]hydrazinyl]-N-[3-(dimethylamino)propyl]-2-oxoacetamide |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2ccc(NNC(=O)C(=O)NCCCN(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H33N5O4S/c1-4-5-7-18-8-14-21(15-9-18)33(31,32)27-20-12-10-19(11-13-20)25-26-23(30)22(29)24-16-6-17-28(2)3/h8-15,25,27H,4-7,16-17H2,1-3H3,(H,24,29)(H,26,30) |
| InChIKey | HUDUVBXXVHVGBJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|