C32H32N2O5S — CID 20728539
2-[(5Z)-5-[[3-[(4-benzylpiperidin-1-yl)methyl]-4-phenylmethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 20728539) has the molecular formula C32H32N2O5S and a molecular weight of 556.68 g/mol. Its IUPAC name is 2-[(5Z)-5-[[3-[(4-benzylpiperidin-1-yl)methyl]-4-phenylmethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[3-[(4-benzylpiperidin-1-yl)methyl]-4-phenylmethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 20728539 |
| Molecular Formula | C32H32N2O5S |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 2-[(5Z)-5-[[3-[(4-benzylpiperidin-1-yl)methyl]-4-phenylmethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)S/C(=C\c2ccc(OCc3ccccc3)c(CN3CCC(Cc4ccccc4)CC3)c2)C1=O |
| InChI | InChI=1S/C32H32N2O5S/c35-30(36)21-34-31(37)29(40-32(34)38)19-26-11-12-28(39-22-25-9-5-2-6-10-25)27(18-26)20-33-15-13-24(14-16-33)17-23-7-3-1-4-8-23/h1-12,18-19,24H,13-17,20-22H2,(H,35,36)/b29-19- |
| InChIKey | BWDTXWRVAQJAJE-CEUNXORHSA-N |
| XLogP | 5.84 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|