C14H12Cl3NO2 — CID 20741872
2,2,2-trichloroethyl 4-phenyl-4H-pyridine-1-carboxylate (PubChem CID 20741872) has the molecular formula C14H12Cl3NO2 and a molecular weight of 332.61 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 4-phenyl-4H-pyridine-1-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 4-phenyl-4H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 20741872 |
| Molecular Formula | C14H12Cl3NO2 |
| Molecular Weight | 332.61 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 2,2,2-trichloroethyl 4-phenyl-4H-pyridine-1-carboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)N1C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C14H12Cl3NO2/c15-14(16,17)10-20-13(19)18-8-6-12(7-9-18)11-4-2-1-3-5-11/h1-9,12H,10H2 |
| InChIKey | LBPYSSCHWDXAFJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|