C13H18O2S4 — CID 20747821
S-[[2-(2-methylprop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] 2-methylprop-2-enethioate (PubChem CID 20747821) has the molecular formula C13H18O2S4 and a molecular weight of 334.55 g/mol. Its IUPAC name is S-[[2-(2-methylprop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] 2-methylprop-2-enethioate.
| Compound Name | S-[[2-(2-methylprop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 20747821 |
| Molecular Formula | C13H18O2S4 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | S-[[2-(2-methylprop-2-enoylsulfanylmethyl)-1,3-dithiolan-4-yl]methyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SCC1CSC(CSC(=O)C(=C)C)S1 |
| InChI | InChI=1S/C13H18O2S4/c1-8(2)12(14)17-6-10-5-16-11(19-10)7-18-13(15)9(3)4/h10-11H,1,3,5-7H2,2,4H3 |
| InChIKey | KSEWFKPIONJQKJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|