C51H33F6N2O7P — CID 20750509
5-[2-[2-[4-[2-diphenylphosphoryl-4-(4-methylphenoxy)phenoxy]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 20750509) has the molecular formula C51H33F6N2O7P and a molecular weight of 930.79 g/mol. Its IUPAC name is 5-[2-[2-[4-[2-diphenylphosphoryl-4-(4-methylphenoxy)phenoxy]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[2-[4-[2-diphenylphosphoryl-4-(4-methylphenoxy)phenoxy]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 20750509 |
| Molecular Formula | C51H33F6N2O7P |
| Molecular Weight | 930.79 g/mol |
| Exact Mass | 930.19 |
| IUPAC Name | 5-[2-[2-[4-[2-diphenylphosphoryl-4-(4-methylphenoxy)phenoxy]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1ccc(Oc2ccc(Oc3ccc(N4C(=O)c5ccc(C(c6ccc7c(c6)C(=O)N(C)C7=O)(C(F)(F)F)C(F)(F)F)cc5C4=O)cc3)c(P(=O)(c3ccccc3)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C51H33F6N2O7P/c1-30-13-19-34(20-14-30)65-36-23-26-43(44(29-36)67(64,37-9-5-3-6-10-37)38-11-7-4-8-12-38)66-35-21-17-33(18-22-35)59-47(62)40-25-16-32(28-42(40)48(59)63)49(50(52,53)54,51(55,56)57)31-15-24-39-41(27-31)46(61)58(2)45(39)60/h3-29H,1-2H3 |
| InChIKey | NIVMFCDSSOAUPW-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.79 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|