C51H37F6N2O9P — CID 20750517
4-[2-[4-carboxy-3-[[4-[2-diphenylphosphoryl-4-(4-methylphenoxy)phenoxy]phenyl]carbamoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(methylcarbamoyl)benzoic acid (PubChem CID 20750517) has the molecular formula C51H37F6N2O9P and a molecular weight of 966.82 g/mol. Its IUPAC name is 4-[2-[4-carboxy-3-[[4-[2-diphenylphosphoryl-4-(4-methylphenoxy)phenoxy]phenyl]carbamoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(methylcarbamoyl)benzoic acid.
| Compound Name | 4-[2-[4-carboxy-3-[[4-[2-diphenylphosphoryl-4-(4-methylphenoxy)phenoxy]phenyl]carbamoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(methylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 20750517 |
| Molecular Formula | C51H37F6N2O9P |
| Molecular Weight | 966.82 g/mol |
| Exact Mass | 966.21 |
| IUPAC Name | 4-[2-[4-carboxy-3-[[4-[2-diphenylphosphoryl-4-(4-methylphenoxy)phenoxy]phenyl]carbamoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(methylcarbamoyl)benzoic acid |
| SMILES | CNC(=O)c1cc(C(c2ccc(C(=O)O)c(C(=O)Nc3ccc(Oc4ccc(Oc5ccc(C)cc5)cc4P(=O)(c4ccccc4)c4ccccc4)cc3)c2)(C(F)(F)F)C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C51H37F6N2O9P/c1-30-13-19-34(20-14-30)67-36-23-26-43(44(29-36)69(66,37-9-5-3-6-10-37)38-11-7-4-8-12-38)68-35-21-17-33(18-22-35)59-46(61)42-28-32(16-25-40(42)48(64)65)49(50(52,53)54,51(55,56)57)31-15-24-39(47(62)63)41(27-31)45(60)58-2/h3-29H,1-2H3,(H,58,60)(H,59,61)(H,62,63)(H,64,65) |
| InChIKey | MMIIPEXGRADIFN-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.82 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|