C25H30F8O2 — CID 20750892
1-[difluoro-[4-(4-propylcyclohexyl)cyclohexen-1-yl]methoxy]-4-methoxy-2,3-bis(trifluoromethyl)benzene (PubChem CID 20750892) has the molecular formula C25H30F8O2 and a molecular weight of 514.50 g/mol. Its IUPAC name is 1-[difluoro-[4-(4-propylcyclohexyl)cyclohexen-1-yl]methoxy]-4-methoxy-2,3-bis(trifluoromethyl)benzene.
| Compound Name | 1-[difluoro-[4-(4-propylcyclohexyl)cyclohexen-1-yl]methoxy]-4-methoxy-2,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 20750892 |
| Molecular Formula | C25H30F8O2 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 1-[difluoro-[4-(4-propylcyclohexyl)cyclohexen-1-yl]methoxy]-4-methoxy-2,3-bis(trifluoromethyl)benzene |
| SMILES | CCCC1CCC(C2CC=C(C(F)(F)Oc3ccc(OC)c(C(F)(F)F)c3C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C25H30F8O2/c1-3-4-15-5-7-16(8-6-15)17-9-11-18(12-10-17)25(32,33)35-20-14-13-19(34-2)21(23(26,27)28)22(20)24(29,30)31/h11,13-17H,3-10,12H2,1-2H3 |
| InChIKey | VAWUBFDGGWOTTD-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|