C26H25N2O9P-2 — CID 20755497
[6-methoxy-3-[4-methoxy-3-(phosphonatoamino)phenyl]-1H-indol-2-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 20755497) has the molecular formula C26H25N2O9P-2 and a molecular weight of 540.47 g/mol. Its IUPAC name is [6-methoxy-3-[4-methoxy-3-(phosphonatoamino)phenyl]-1H-indol-2-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [6-methoxy-3-[4-methoxy-3-(phosphonatoamino)phenyl]-1H-indol-2-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 20755497 |
| Molecular Formula | C26H25N2O9P-2 |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | [6-methoxy-3-[4-methoxy-3-(phosphonatoamino)phenyl]-1H-indol-2-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1ccc2c(-c3ccc(OC)c(NP(=O)([O-])[O-])c3)c(C(=O)c3cc(OC)c(OC)c(OC)c3)[nH]c2c1 |
| InChI | InChI=1S/C26H27N2O9P/c1-33-16-7-8-17-18(13-16)27-24(25(29)15-11-21(35-3)26(37-5)22(12-15)36-4)23(17)14-6-9-20(34-2)19(10-14)28-38(30,31)32/h6-13,27H,1-5H3,(H3,28,30,31,32)/p-2 |
| InChIKey | WHPIOBUDCNDRIW-UHFFFAOYSA-L |
| XLogP | 3.35 |
| TPSA | 154.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|