C26H28N2O6 — CID 142051543
[3-(3-amino-4-methoxyphenyl)-6-methoxy-1H-indol-2-yl]-(3,4,5-trimethoxyphenyl)methanol (PubChem CID 142051543) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is [3-(3-amino-4-methoxyphenyl)-6-methoxy-1H-indol-2-yl]-(3,4,5-trimethoxyphenyl)methanol.
| Compound Name | [3-(3-amino-4-methoxyphenyl)-6-methoxy-1H-indol-2-yl]-(3,4,5-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 142051543 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | [3-(3-amino-4-methoxyphenyl)-6-methoxy-1H-indol-2-yl]-(3,4,5-trimethoxyphenyl)methanol |
| SMILES | COc1ccc2c(-c3ccc(OC)c(N)c3)c(C(O)c3cc(OC)c(OC)c(OC)c3)[nH]c2c1 |
| InChI | InChI=1S/C26H28N2O6/c1-30-16-7-8-17-19(13-16)28-24(23(17)14-6-9-20(31-2)18(27)10-14)25(29)15-11-21(32-3)26(34-5)22(12-15)33-4/h6-13,25,28-29H,27H2,1-5H3 |
| InChIKey | MZSUQXOYZQPYNR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|