C32H32N4O3 — CID 20756582
tert-butyl N-[(1S)-2-(1H-indol-3-yl)-1-(1-phenacyl-4-phenylimidazol-2-yl)ethyl]carbamate (PubChem CID 20756582) has the molecular formula C32H32N4O3 and a molecular weight of 520.63 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-(1H-indol-3-yl)-1-(1-phenacyl-4-phenylimidazol-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-(1H-indol-3-yl)-1-(1-phenacyl-4-phenylimidazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 20756582 |
| Molecular Formula | C32H32N4O3 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | tert-butyl N-[(1S)-2-(1H-indol-3-yl)-1-(1-phenacyl-4-phenylimidazol-2-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1c[nH]c2ccccc12)c1nc(-c2ccccc2)cn1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H32N4O3/c1-32(2,3)39-31(38)35-27(18-24-19-33-26-17-11-10-16-25(24)26)30-34-28(22-12-6-4-7-13-22)20-36(30)21-29(37)23-14-8-5-9-15-23/h4-17,19-20,27,33H,18,21H2,1-3H3,(H,35,38)/t27-/m0/s1 |
| InChIKey | GHNCQZNSTCYEKM-MHZLTWQESA-N |
| XLogP | 6.72 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |