C38H49N2O2+ — CID 20764791
3-hydroxy-4-[2-methyl-1-(3-methylheptan-2-yl)indol-1-ium-3-ylidene]-2-[2-methyl-1-(3-methylheptan-2-yl)indol-3-yl]cyclobut-2-en-1-one (PubChem CID 20764791) has the molecular formula C38H49N2O2+ and a molecular weight of 565.82 g/mol. Its IUPAC name is 3-hydroxy-4-[2-methyl-1-(3-methylheptan-2-yl)indol-1-ium-3-ylidene]-2-[2-methyl-1-(3-methylheptan-2-yl)indol-3-yl]cyclobut-2-en-1-one.
| Compound Name | 3-hydroxy-4-[2-methyl-1-(3-methylheptan-2-yl)indol-1-ium-3-ylidene]-2-[2-methyl-1-(3-methylheptan-2-yl)indol-3-yl]cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 20764791 |
| Molecular Formula | C38H49N2O2+ |
| Molecular Weight | 565.82 g/mol |
| Exact Mass | 565.38 |
| IUPAC Name | 3-hydroxy-4-[2-methyl-1-(3-methylheptan-2-yl)indol-1-ium-3-ylidene]-2-[2-methyl-1-(3-methylheptan-2-yl)indol-3-yl]cyclobut-2-en-1-one |
| SMILES | CCCCC(C)C(C)n1c(C)c(C2=C(O)C(=C3C(C)=[N+](C(C)C(C)CCCC)c4ccccc43)C2=O)c2ccccc21 |
| InChI | InChI=1S/C38H48N2O2/c1-9-11-17-23(3)25(5)39-27(7)33(29-19-13-15-21-31(29)39)35-37(41)36(38(35)42)34-28(8)40(26(6)24(4)18-12-10-2)32-22-16-14-20-30(32)34/h13-16,19-26H,9-12,17-18H2,1-8H3/p+1 |
| InChIKey | GMZRJIWRVRJSMO-UHFFFAOYSA-O |
| XLogP | 9.98 |
| TPSA | 45.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.82 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|