C28H25Cl3N4O4 — CID 20765006
N-ethyl-4,6-dimethyl-N-[3-[[5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]carbamoyl]phenyl]-1-oxaspiro[2.5]octa-5,7-diene-2-carboxamide (PubChem CID 20765006) has the molecular formula C28H25Cl3N4O4 and a molecular weight of 587.89 g/mol. Its IUPAC name is N-ethyl-4,6-dimethyl-N-[3-[[5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]carbamoyl]phenyl]-1-oxaspiro[2.5]octa-5,7-diene-2-carboxamide.
| Compound Name | N-ethyl-4,6-dimethyl-N-[3-[[5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]carbamoyl]phenyl]-1-oxaspiro[2.5]octa-5,7-diene-2-carboxamide |
|---|---|
| PubChem CID | 20765006 |
| Molecular Formula | C28H25Cl3N4O4 |
| Molecular Weight | 587.89 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | N-ethyl-4,6-dimethyl-N-[3-[[5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]carbamoyl]phenyl]-1-oxaspiro[2.5]octa-5,7-diene-2-carboxamide |
| SMILES | CCN(C(=O)C1OC12C=CC(C)=CC2C)c1cccc(C(=O)NC2=NN(c3c(Cl)cc(Cl)cc3Cl)C(=O)C2)c1 |
| InChI | InChI=1S/C28H25Cl3N4O4/c1-4-34(27(38)25-28(39-25)9-8-15(2)10-16(28)3)19-7-5-6-17(11-19)26(37)32-22-14-23(36)35(33-22)24-20(30)12-18(29)13-21(24)31/h5-13,16,25H,4,14H2,1-3H3,(H,32,33,37) |
| InChIKey | RGYIBAHEVCBSLQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.89 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|