About 10-bromodec-8-yn-4-one
10-bromodec-8-yn-4-one (PubChem CID 20765013) has the molecular formula C10H15BrO
and a molecular weight of 231.13 g/mol. Its IUPAC name is 10-bromodec-8-yn-4-one.
Molecular Properties
| Compound Name | 10-bromodec-8-yn-4-one |
| PubChem CID | 20765013 |
| Molecular Formula | C10H15BrO |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 10-bromodec-8-yn-4-one |
| SMILES | CCCC(=O)CCCC#CCBr |
| InChI | InChI=1S/C10H15BrO/c1-2-7-10(12)8-5-3-4-6-9-11/h2-3,5,7-9H2,1H3 |
| InChIKey | UOAJGKFEDKNVJQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 10-bromodec-8-yn-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-bromodec-8-yn-4-one?
The IUPAC name of 10-bromodec-8-yn-4-one (CID 20765013) is 10-bromodec-8-yn-4-one.
What is the SMILES notation for 10-bromodec-8-yn-4-one?
The canonical SMILES for 10-bromodec-8-yn-4-one is CCCC(=O)CCCC#CCBr.
What is the InChIKey of 10-bromodec-8-yn-4-one?
The InChIKey is UOAJGKFEDKNVJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BrO/c1-2-7-10(12)8-5-3-4-6-9-11/h2-3,5,7-9H2,1H3.
What are the key properties of 10-bromodec-8-yn-4-one?
10-bromodec-8-yn-4-one has a molecular weight of 231.13 g/mol, XLogP of 2.92, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-bromodec-8-yn-4-one is sourced from PubChem (CID 20765013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).