2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid

C3H9BNO3P — CID 20767733

IUPAC2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid
SMILESCB(O)NC(P)C(=O)O
InChIInChI=1S/C3H9BNO3P/c1-4(8)5-2(9)3(6)7/h2,5,8H,9H2,1H3,(H,6,7)
InChIKeyTUPXHPIXKNUTFP-UHFFFAOYSA-N
MW148.90 g/mol
LogP-1.03
Rot. Bonds3

About 2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid

2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid (PubChem CID 20767733) has the molecular formula C3H9BNO3P and a molecular weight of 148.90 g/mol. Its IUPAC name is 2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid.

Molecular Properties

Compound Name2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid
PubChem CID20767733
Molecular FormulaC3H9BNO3P
Molecular Weight148.90 g/mol
Exact Mass149.04
IUPAC Name2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid
SMILESCB(O)NC(P)C(=O)O
InChIInChI=1S/C3H9BNO3P/c1-4(8)5-2(9)3(6)7/h2,5,8H,9H2,1H3,(H,6,7)
InChIKeyTUPXHPIXKNUTFP-UHFFFAOYSA-N
XLogP-1.03
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500148.90
LogP ≤ 5-1.03
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid?
The IUPAC name of 2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid (CID 20767733) is 2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid.
What is the SMILES notation for 2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid?
The canonical SMILES for 2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid is CB(O)NC(P)C(=O)O.
What is the InChIKey of 2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid?
The InChIKey is TUPXHPIXKNUTFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9BNO3P/c1-4(8)5-2(9)3(6)7/h2,5,8H,9H2,1H3,(H,6,7).
What are the key properties of 2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid?
2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid has a molecular weight of 148.90 g/mol, XLogP of -1.03, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[hydroxy(methyl)boranyl]amino]-2-phosphanylacetic acid is sourced from PubChem (CID 20767733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).