C4H11N2O4P — CID 141414577
azanium 2-[[carboxy(phosphanyl)methyl]amino]acetate (PubChem CID 141414577) has the molecular formula C4H11N2O4P and a molecular weight of 182.12 g/mol. Its IUPAC name is azanium 2-[[carboxy(phosphanyl)methyl]amino]acetate.
| Compound Name | azanium 2-[[carboxy(phosphanyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 141414577 |
| Molecular Formula | C4H11N2O4P |
| Molecular Weight | 182.12 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | azanium 2-[[carboxy(phosphanyl)methyl]amino]acetate |
| SMILES | O=C([O-])CNC(P)C(=O)O.[NH4+] |
| InChI | InChI=1S/C4H8NO4P.H3N/c6-2(7)1-5-3(10)4(8)9;/h3,5H,1,10H2,(H,6,7)(H,8,9);1H3 |
| InChIKey | BTWQJFGWNIXSDG-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.12 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|