C26H29NaO5S — CID 20783023
sodium 2-(4-nona-1,2,3,4,5,6,7,8-octaenyl-2-nonylphenoxy)ethyl sulfate (PubChem CID 20783023) has the molecular formula C26H29NaO5S and a molecular weight of 476.57 g/mol. Its IUPAC name is sodium 2-(4-nona-1,2,3,4,5,6,7,8-octaenyl-2-nonylphenoxy)ethyl sulfate.
| Compound Name | sodium 2-(4-nona-1,2,3,4,5,6,7,8-octaenyl-2-nonylphenoxy)ethyl sulfate |
|---|---|
| PubChem CID | 20783023 |
| Molecular Formula | C26H29NaO5S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | sodium 2-(4-nona-1,2,3,4,5,6,7,8-octaenyl-2-nonylphenoxy)ethyl sulfate |
| SMILES | C=C=C=C=C=C=C=C=Cc1ccc(OCCOS(=O)(=O)[O-])c(CCCCCCCCC)c1.[Na+] |
| InChI | InChI=1S/C26H30O5S.Na/c1-3-5-7-9-11-13-15-17-24-19-20-26(30-21-22-31-32(27,28)29)25(23-24)18-16-14-12-10-8-6-4-2;/h17,19-20,23H,1,4,6,8,10,12,14,16,18,21-22H2,2H3,(H,27,28,29);/q;+1/p-1 |
| InChIKey | IQUUCTZIKVPCAQ-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|