C17H13N2O+ — CID 20784127
2-phenyl-3H-benzo[h][4,1,2]benzoxadiazin-2-ium (PubChem CID 20784127) has the molecular formula C17H13N2O+ and a molecular weight of 261.30 g/mol. Its IUPAC name is 2-phenyl-3H-benzo[h][4,1,2]benzoxadiazin-2-ium.
| Compound Name | 2-phenyl-3H-benzo[h][4,1,2]benzoxadiazin-2-ium |
|---|---|
| PubChem CID | 20784127 |
| Molecular Formula | C17H13N2O+ |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-phenyl-3H-benzo[h][4,1,2]benzoxadiazin-2-ium |
| SMILES | c1ccc([N+]2=Nc3c(ccc4ccccc34)OC2)cc1 |
| InChI | InChI=1S/C17H13N2O/c1-2-7-14(8-3-1)19-12-20-16-11-10-13-6-4-5-9-15(13)17(16)18-19/h1-11H,12H2/q+1 |
| InChIKey | LLVGOTHEWKQUOX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|