C32H44N2O2P2S2 — CID 160670834
3H-benzo[f][1,4]benzoxazine;2H-benzo[h][1,4]benzoxazine;ethane;sulfanylidenephosphane (PubChem CID 160670834) has the molecular formula C32H44N2O2P2S2 and a molecular weight of 614.80 g/mol. Its IUPAC name is 3H-benzo[f][1,4]benzoxazine;2H-benzo[h][1,4]benzoxazine;ethane;sulfanylidenephosphane.
| Compound Name | 3H-benzo[f][1,4]benzoxazine;2H-benzo[h][1,4]benzoxazine;ethane;sulfanylidenephosphane |
|---|---|
| PubChem CID | 160670834 |
| Molecular Formula | C32H44N2O2P2S2 |
| Molecular Weight | 614.80 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | 3H-benzo[f][1,4]benzoxazine;2H-benzo[h][1,4]benzoxazine;ethane;sulfanylidenephosphane |
| SMILES | C1=Nc2c(ccc3ccccc23)OC1.C1=Nc2ccc3ccccc3c2OC1.CC.CC.CC.CC.P=S.P=S |
| InChI | InChI=1S/2C12H9NO.4C2H6.2HPS/c1-2-4-10-9(3-1)5-6-11-12(10)13-7-8-14-11;1-2-4-10-9(3-1)5-6-11-12(10)14-8-7-13-11;6*1-2/h2*1-7H,8H2;4*1-2H3;2*1H |
| InChIKey | RMXHBQUJBJREPN-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.80 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|