C31H36N2O6 — CID 101446608
19,20,20-trimethylspiro[2,5,8,11,14-pentaoxa-19-azatricyclo[13.8.0.017,22]tricosa-1(15),16,22-triene-18,3'-benzo[f][1,4]benzoxazine] (PubChem CID 101446608) has the molecular formula C31H36N2O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is 19,20,20-trimethylspiro[2,5,8,11,14-pentaoxa-19-azatricyclo[13.8.0.017,22]tricosa-1(15),16,22-triene-18,3'-benzo[f][1,4]benzoxazine].
| Compound Name | 19,20,20-trimethylspiro[2,5,8,11,14-pentaoxa-19-azatricyclo[13.8.0.017,22]tricosa-1(15),16,22-triene-18,3'-benzo[f][1,4]benzoxazine] |
|---|---|
| PubChem CID | 101446608 |
| Molecular Formula | C31H36N2O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 19,20,20-trimethylspiro[2,5,8,11,14-pentaoxa-19-azatricyclo[13.8.0.017,22]tricosa-1(15),16,22-triene-18,3'-benzo[f][1,4]benzoxazine] |
| SMILES | CN1C(C)(C)Cc2cc3c(cc2C12C=Nc1c(ccc4ccccc14)O2)OCCOCCOCCOCCO3 |
| InChI | InChI=1S/C31H36N2O6/c1-30(2)20-23-18-27-28(38-17-15-36-13-11-34-10-12-35-14-16-37-27)19-25(23)31(33(30)3)21-32-29-24-7-5-4-6-22(24)8-9-26(29)39-31/h4-9,18-19,21H,10-17,20H2,1-3H3 |
| InChIKey | LJNBGLWLGZMUOV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 70.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |