C11H14N4 — CID 20785473
6-piperazin-1-ylimidazo[1,2-a]pyridine (PubChem CID 20785473) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 6-piperazin-1-ylimidazo[1,2-a]pyridine.
| Compound Name | 6-piperazin-1-ylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 20785473 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 6-piperazin-1-ylimidazo[1,2-a]pyridine |
| SMILES | c1cn2cc(N3CCNCC3)ccc2n1 |
| InChI | InChI=1S/C11H14N4/c1-2-11-13-5-8-15(11)9-10(1)14-6-3-12-4-7-14/h1-2,5,8-9,12H,3-4,6-7H2 |
| InChIKey | GJRHYSICCPFVIS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |