C20H29N9O2 — CID 20785528
4-hydrazinyl-1-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 20785528) has the molecular formula C20H29N9O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 4-hydrazinyl-1-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 4-hydrazinyl-1-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 20785528 |
| Molecular Formula | C20H29N9O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 4-hydrazinyl-1-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | COCCOc1ccc(N2CCN(CCn3ncc4c(NN)nc(N)nc43)CC2)cc1 |
| InChI | InChI=1S/C20H29N9O2/c1-30-12-13-31-16-4-2-15(3-5-16)28-9-6-27(7-10-28)8-11-29-19-17(14-23-29)18(26-22)24-20(21)25-19/h2-5,14H,6-13,22H2,1H3,(H3,21,24,25,26) |
| InChIKey | SJOIDOBDTDZNDT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|