C25H33N9O4 — CID 58834784
N'-[6-amino-1-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]pyrazolo[3,4-d]pyrimidin-4-yl]-2,3-dihydrofuran-5-carbohydrazide (PubChem CID 58834784) has the molecular formula C25H33N9O4 and a molecular weight of 523.60 g/mol. Its IUPAC name is N'-[6-amino-1-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]pyrazolo[3,4-d]pyrimidin-4-yl]-2,3-dihydrofuran-5-carbohydrazide.
| Compound Name | N'-[6-amino-1-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]pyrazolo[3,4-d]pyrimidin-4-yl]-2,3-dihydrofuran-5-carbohydrazide |
|---|---|
| PubChem CID | 58834784 |
| Molecular Formula | C25H33N9O4 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | N'-[6-amino-1-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]pyrazolo[3,4-d]pyrimidin-4-yl]-2,3-dihydrofuran-5-carbohydrazide |
| SMILES | COCCOc1ccc(N2CCN(CCn3ncc4c(NNC(=O)C5=CCCO5)nc(N)nc43)CC2)cc1 |
| InChI | InChI=1S/C25H33N9O4/c1-36-15-16-37-19-6-4-18(5-7-19)33-11-8-32(9-12-33)10-13-34-23-20(17-27-34)22(28-25(26)29-23)30-31-24(35)21-3-2-14-38-21/h3-7,17H,2,8-16H2,1H3,(H,31,35)(H3,26,28,29,30) |
| InChIKey | NOKHAHOEZCPSTH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|