C22H34N8O4 — CID 23540128
methyl N-[[2-amino-6-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl-methylamino]pyrimidin-4-yl]amino]carbamate (PubChem CID 23540128) has the molecular formula C22H34N8O4 and a molecular weight of 474.57 g/mol. Its IUPAC name is methyl N-[[2-amino-6-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl-methylamino]pyrimidin-4-yl]amino]carbamate.
| Compound Name | methyl N-[[2-amino-6-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl-methylamino]pyrimidin-4-yl]amino]carbamate |
|---|---|
| PubChem CID | 23540128 |
| Molecular Formula | C22H34N8O4 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | methyl N-[[2-amino-6-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl-methylamino]pyrimidin-4-yl]amino]carbamate |
| SMILES | COCCOc1ccc(N2CCN(CCN(C)c3cc(NNC(=O)OC)nc(N)n3)CC2)cc1 |
| InChI | InChI=1S/C22H34N8O4/c1-28(20-16-19(24-21(23)25-20)26-27-22(31)33-3)8-9-29-10-12-30(13-11-29)17-4-6-18(7-5-17)34-15-14-32-2/h4-7,16H,8-15H2,1-3H3,(H,27,31)(H3,23,24,25,26) |
| InChIKey | MWWANASCAKSGMX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 130.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|