C8H6Cl2N4 — CID 20788369
4-(3,4-dichlorophenyl)triazol-1-amine (PubChem CID 20788369) has the molecular formula C8H6Cl2N4 and a molecular weight of 229.07 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)triazol-1-amine.
| Compound Name | 4-(3,4-dichlorophenyl)triazol-1-amine |
|---|---|
| PubChem CID | 20788369 |
| Molecular Formula | C8H6Cl2N4 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 4-(3,4-dichlorophenyl)triazol-1-amine |
| SMILES | Nn1cc(-c2ccc(Cl)c(Cl)c2)nn1 |
| InChI | InChI=1S/C8H6Cl2N4/c9-6-2-1-5(3-7(6)10)8-4-14(11)13-12-8/h1-4H,11H2 |
| InChIKey | OCWVZHIPJWZLCA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |