C13H12O4W — CID 20789711
CID 20789711 (PubChem CID 20789711) has the molecular formula C13H12O4W and a molecular weight of 416.08 g/mol.
| Compound Name | CID 20789711 |
|---|---|
| PubChem CID | 20789711 |
| Molecular Formula | C13H12O4W |
| Molecular Weight | 416.08 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | — |
| SMILES | O=C1CC2(CC3OC2C2[CH-]C=C[CH-]C32)C(=O)O1.[W+2] |
| InChI | InChI=1S/C13H12O4.W/c14-10-6-13(12(15)17-10)5-9-7-3-1-2-4-8(7)11(13)16-9;/h1-4,7-9,11H,5-6H2;/q-2;+2 |
| InChIKey | HRQJXIXCZHXIJW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.08 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|