C21H25N3O2SSi — CID 20795943
2-(2-amino-1,3-thiazol-4-yl)-N-[tert-butyl(diphenyl)silyl]oxyacetamide (PubChem CID 20795943) has the molecular formula C21H25N3O2SSi and a molecular weight of 411.60 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[tert-butyl(diphenyl)silyl]oxyacetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[tert-butyl(diphenyl)silyl]oxyacetamide |
|---|---|
| PubChem CID | 20795943 |
| Molecular Formula | C21H25N3O2SSi |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[tert-butyl(diphenyl)silyl]oxyacetamide |
| SMILES | CC(C)(C)[Si](ONC(=O)Cc1csc(N)n1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O2SSi/c1-21(2,3)28(17-10-6-4-7-11-17,18-12-8-5-9-13-18)26-24-19(25)14-16-15-27-20(22)23-16/h4-13,15H,14H2,1-3H3,(H2,22,23)(H,24,25) |
| InChIKey | HBJFAQKTXFBDCN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|