C39H3N3O3 — CID 20804896
1,1,1-triisocyanatohexatriaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34-heptadecayne (PubChem CID 20804896) has the molecular formula C39H3N3O3 and a molecular weight of 561.47 g/mol. Its IUPAC name is 1,1,1-triisocyanatohexatriaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34-heptadecayne.
| Compound Name | 1,1,1-triisocyanatohexatriaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34-heptadecayne |
|---|---|
| PubChem CID | 20804896 |
| Molecular Formula | C39H3N3O3 |
| Molecular Weight | 561.47 g/mol |
| Exact Mass | 561.02 |
| IUPAC Name | 1,1,1-triisocyanatohexatriaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34-heptadecayne |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC(N=C=O)(N=C=O)N=C=O |
| InChI | InChI=1S/C39H3N3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-31-32-33-34-35-39(40-36-43,41-37-44)42-38-45/h1H3 |
| InChIKey | OXXIXVMSGBPXSX-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.47 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|