C24H29FN2O4 — CID 20810220
tert-butyl N-[fluoro-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]methyl]-N-(3-phenylpropyl)carbamate (PubChem CID 20810220) has the molecular formula C24H29FN2O4 and a molecular weight of 428.50 g/mol. Its IUPAC name is tert-butyl N-[fluoro-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]methyl]-N-(3-phenylpropyl)carbamate.
| Compound Name | tert-butyl N-[fluoro-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]methyl]-N-(3-phenylpropyl)carbamate |
|---|---|
| PubChem CID | 20810220 |
| Molecular Formula | C24H29FN2O4 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | tert-butyl N-[fluoro-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]methyl]-N-(3-phenylpropyl)carbamate |
| SMILES | C[C@H]1Oc2ccc(C(F)N(CCCc3ccccc3)C(=O)OC(C)(C)C)cc2NC1=O |
| InChI | InChI=1S/C24H29FN2O4/c1-16-22(28)26-19-15-18(12-13-20(19)30-16)21(25)27(23(29)31-24(2,3)4)14-8-11-17-9-6-5-7-10-17/h5-7,9-10,12-13,15-16,21H,8,11,14H2,1-4H3,(H,26,28)/t16-,21?/m1/s1 |
| InChIKey | PHSGSAAPVGCFRI-UJONTBEJSA-N |
| XLogP | 5.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|