C14H14N2O2 — CID 20815017
N-(3-methoxyphenyl)-N-(4-methylphenyl)nitrous amide (PubChem CID 20815017) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-N-(4-methylphenyl)nitrous amide.
| Compound Name | N-(3-methoxyphenyl)-N-(4-methylphenyl)nitrous amide |
|---|---|
| PubChem CID | 20815017 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-(3-methoxyphenyl)-N-(4-methylphenyl)nitrous amide |
| SMILES | COc1cccc(N(N=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C14H14N2O2/c1-11-6-8-12(9-7-11)16(15-17)13-4-3-5-14(10-13)18-2/h3-10H,1-2H3 |
| InChIKey | LLQXXNBFNUAETE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|