C11H20N6+2 — CID 20816744
1,4,5-trimethyl-3-[(1,4,5-trimethyl-1,2,4-triazol-4-ium-3-yl)methyl]-1,2,4-triazol-4-ium (PubChem CID 20816744) has the molecular formula C11H20N6+2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 1,4,5-trimethyl-3-[(1,4,5-trimethyl-1,2,4-triazol-4-ium-3-yl)methyl]-1,2,4-triazol-4-ium.
| Compound Name | 1,4,5-trimethyl-3-[(1,4,5-trimethyl-1,2,4-triazol-4-ium-3-yl)methyl]-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 20816744 |
| Molecular Formula | C11H20N6+2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 1,4,5-trimethyl-3-[(1,4,5-trimethyl-1,2,4-triazol-4-ium-3-yl)methyl]-1,2,4-triazol-4-ium |
| SMILES | Cc1n(C)nc(Cc2nn(C)c(C)[n+]2C)[n+]1C |
| InChI | InChI=1S/C11H20N6/c1-8-14(3)10(12-16(8)5)7-11-13-17(6)9(2)15(11)4/h7H2,1-6H3/q+2 |
| InChIKey | IOKOPNGWXFDAKW-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|