C9H15NO3 — CID 20821668
2,3,4,6,7,9a-hexahydro-1H-quinolizine-1,2,3-triol (PubChem CID 20821668) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 2,3,4,6,7,9a-hexahydro-1H-quinolizine-1,2,3-triol.
| Compound Name | 2,3,4,6,7,9a-hexahydro-1H-quinolizine-1,2,3-triol |
|---|---|
| PubChem CID | 20821668 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2,3,4,6,7,9a-hexahydro-1H-quinolizine-1,2,3-triol |
| SMILES | OC1CN2CCC=CC2C(O)C1O |
| InChI | InChI=1S/C9H15NO3/c11-7-5-10-4-2-1-3-6(10)8(12)9(7)13/h1,3,6-9,11-13H,2,4-5H2 |
| InChIKey | GOHAECJNRKPGAN-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|