C25H22F6N2O5 — CID 20822514
3-[[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 20822514) has the molecular formula C25H22F6N2O5 and a molecular weight of 544.45 g/mol. Its IUPAC name is 3-[[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-[[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 20822514 |
| Molecular Formula | C25H22F6N2O5 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 3-[[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CNc1cc(C(c2ccc(O)c(NC(=O)C3C4C=CC(C4)C3C(=O)O)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C25H22F6N2O5/c1-32-15-9-13(4-6-17(15)34)23(24(26,27)28,25(29,30)31)14-5-7-18(35)16(10-14)33-21(36)19-11-2-3-12(8-11)20(19)22(37)38/h2-7,9-12,19-20,32,34-35H,8H2,1H3,(H,33,36)(H,37,38) |
| InChIKey | NDLQWFHVAVNTPP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|