C33H26F6N2O7 — CID 20822515
3-[[5-[2-[3-[(3-acetylbenzoyl)amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 20822515) has the molecular formula C33H26F6N2O7 and a molecular weight of 676.57 g/mol. Its IUPAC name is 3-[[5-[2-[3-[(3-acetylbenzoyl)amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-[[5-[2-[3-[(3-acetylbenzoyl)amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 20822515 |
| Molecular Formula | C33H26F6N2O7 |
| Molecular Weight | 676.57 g/mol |
| Exact Mass | 676.16 |
| IUPAC Name | 3-[[5-[2-[3-[(3-acetylbenzoyl)amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CC(=O)c1cccc(C(=O)Nc2cc(C(c3ccc(O)c(NC(=O)C4C5C=CC(C5)C4C(=O)O)c3)(C(F)(F)F)C(F)(F)F)ccc2O)c1 |
| InChI | InChI=1S/C33H26F6N2O7/c1-15(42)16-3-2-4-19(11-16)28(45)40-22-13-20(7-9-24(22)43)31(32(34,35)36,33(37,38)39)21-8-10-25(44)23(14-21)41-29(46)26-17-5-6-18(12-17)27(26)30(47)48/h2-11,13-14,17-18,26-27,43-44H,12H2,1H3,(H,40,45)(H,41,46)(H,47,48) |
| InChIKey | JIUBHAQUTLBYHK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|