C8H15N2O7- — CID 20831664
(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[[(Z)-[methyl(oxido)azaniumylidene]amino]methoxy]oxan-2-olate (PubChem CID 20831664) has the molecular formula C8H15N2O7- and a molecular weight of 251.21 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[[(Z)-[methyl(oxido)azaniumylidene]amino]methoxy]oxan-2-olate.
| Compound Name | (2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[[(Z)-[methyl(oxido)azaniumylidene]amino]methoxy]oxan-2-olate |
|---|---|
| PubChem CID | 20831664 |
| Molecular Formula | C8H15N2O7- |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[[(Z)-[methyl(oxido)azaniumylidene]amino]methoxy]oxan-2-olate |
| SMILES | C/[N+]([O-])=N/CO[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1[O-] |
| InChI | InChI=1S/C8H15N2O7/c1-10(15)9-3-16-7-6(13)5(12)4(2-11)17-8(7)14/h4-8,11-13H,2-3H2,1H3/q-1/b10-9-/t4-,5-,6+,7-,8-/m1/s1 |
| InChIKey | HMRBWHREBPGLED-LBCXAKKBSA-N |
| XLogP | -3.28 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|