C55H74N2O5S+2 — CID 20835211
4-[(E)-2-(4-heptoxyphenyl)ethenyl]-1-[8-[4-[(E)-2-(4-heptoxyphenyl)ethenyl]pyridin-1-ium-1-yl]octyl]pyridin-1-ium;4-methylbenzenesulfonic acid (PubChem CID 20835211) has the molecular formula C55H74N2O5S+2 and a molecular weight of 875.27 g/mol. Its IUPAC name is 4-[(E)-2-(4-heptoxyphenyl)ethenyl]-1-[8-[4-[(E)-2-(4-heptoxyphenyl)ethenyl]pyridin-1-ium-1-yl]octyl]pyridin-1-ium;4-methylbenzenesulfonic acid.
| Compound Name | 4-[(E)-2-(4-heptoxyphenyl)ethenyl]-1-[8-[4-[(E)-2-(4-heptoxyphenyl)ethenyl]pyridin-1-ium-1-yl]octyl]pyridin-1-ium;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 20835211 |
| Molecular Formula | C55H74N2O5S+2 |
| Molecular Weight | 875.27 g/mol |
| Exact Mass | 874.53 |
| IUPAC Name | 4-[(E)-2-(4-heptoxyphenyl)ethenyl]-1-[8-[4-[(E)-2-(4-heptoxyphenyl)ethenyl]pyridin-1-ium-1-yl]octyl]pyridin-1-ium;4-methylbenzenesulfonic acid |
| SMILES | CCCCCCCOc1ccc(/C=C/c2cc[n+](CCCCCCCC[n+]3ccc(/C=C/c4ccc(OCCCCCCC)cc4)cc3)cc2)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C48H66N2O2.C7H8O3S/c1-3-5-7-13-17-41-51-47-27-23-43(24-28-47)19-21-45-31-37-49(38-32-45)35-15-11-9-10-12-16-36-50-39-33-46(34-40-50)22-20-44-25-29-48(30-26-44)52-42-18-14-8-6-4-2;1-6-2-4-7(5-3-6)11(8,9)10/h19-34,37-40H,3-18,35-36,41-42H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+2;/b21-19+,22-20+; |
| InChIKey | DJVROJRPKGTJPK-ULQNKYRSSA-N |
| XLogP | 13.58 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.27 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|