C23H28N4O8-4 — CID 20836587
N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine;oxalate (PubChem CID 20836587) has the molecular formula C23H28N4O8-4 and a molecular weight of 488.50 g/mol. Its IUPAC name is N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine;oxalate.
| Compound Name | N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine;oxalate |
|---|---|
| PubChem CID | 20836587 |
| Molecular Formula | C23H28N4O8-4 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-(4-methyl-6-phenylpyridazin-3-yl)-N',N'-dipropylethane-1,2-diamine;oxalate |
| SMILES | CCCN(CCC)CCNc1nnc(-c2ccccc2)cc1C.O=C([O-])C(=O)[O-].O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/C19H28N4.2C2H2O4/c1-4-12-23(13-5-2)14-11-20-19-16(3)15-18(21-22-19)17-9-7-6-8-10-17;2*3-1(4)2(5)6/h6-10,15H,4-5,11-14H2,1-3H3,(H,20,22);2*(H,3,4)(H,5,6)/p-4 |
| InChIKey | NGBRVECKPWELJF-UHFFFAOYSA-J |
| XLogP | -3.04 |
| TPSA | 201.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|