C17H15N3 — CID 59867404
4-methyl-N,6-diphenylpyridazin-3-amine (PubChem CID 59867404) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is 4-methyl-N,6-diphenylpyridazin-3-amine.
| Compound Name | 4-methyl-N,6-diphenylpyridazin-3-amine |
|---|---|
| PubChem CID | 59867404 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 4-methyl-N,6-diphenylpyridazin-3-amine |
| SMILES | Cc1cc(-c2ccccc2)nnc1Nc1ccccc1 |
| InChI | InChI=1S/C17H15N3/c1-13-12-16(14-8-4-2-5-9-14)19-20-17(13)18-15-10-6-3-7-11-15/h2-12H,1H3,(H,18,20) |
| InChIKey | WDMNPSLSORUSIJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |